C13H23IN6O2S — CID 109486745
2-ethyl-N'-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 109486745) has the molecular formula C13H23IN6O2S and a molecular weight of 454.34 g/mol. Its IUPAC name is 2-ethyl-N'-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | 2-ethyl-N'-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109486745 |
| Molecular Formula | C13H23IN6O2S |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 2-ethyl-N'-methyl-N-[2-(4-nitropyrazol-1-yl)ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC1CN(/C(=N/C)NCCn2cc([N+](=O)[O-])cn2)CCS1.I |
| InChI | InChI=1S/C13H22N6O2S.HI/c1-3-12-10-17(6-7-22-12)13(14-2)15-4-5-18-9-11(8-16-18)19(20)21;/h8-9,12H,3-7,10H2,1-2H3,(H,14,15);1H |
| InChIKey | WYDKIWLBGDBWTG-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 88.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|