C14H26N6S — CID 109485640
2-ethyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylthiomorpholine-4-carboximidamide (PubChem CID 109485640) has the molecular formula C14H26N6S and a molecular weight of 310.47 g/mol. Its IUPAC name is 2-ethyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylthiomorpholine-4-carboximidamide.
| Compound Name | 2-ethyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylthiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 109485640 |
| Molecular Formula | C14H26N6S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-ethyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylthiomorpholine-4-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\C)N1CCSC(CC)C1 |
| InChI | InChI=1S/C14H26N6S/c1-4-12-10-19(8-9-21-12)14(15-3)16-6-7-20-11-17-18-13(20)5-2/h11-12H,4-10H2,1-3H3,(H,15,16) |
| InChIKey | IAJIBMAGYMLLEH-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|