C20H32IN7 — CID 111513105
4-(2,3-dimethylphenyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111513105) has the molecular formula C20H32IN7 and a molecular weight of 497.43 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,3-dimethylphenyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111513105 |
| Molecular Formula | C20H32IN7 |
| Molecular Weight | 497.43 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\C)N1CCN(c2cccc(C)c2C)CC1.I |
| InChI | InChI=1S/C20H31N7.HI/c1-5-19-24-23-15-27(19)10-9-22-20(21-4)26-13-11-25(12-14-26)18-8-6-7-16(2)17(18)3;/h6-8,15H,5,9-14H2,1-4H3,(H,21,22);1H |
| InChIKey | LZHHHISWZPESGR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|