C22H34IN7 — CID 136923543
4-(2,3-dimethylphenyl)-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 136923543) has the molecular formula C22H34IN7 and a molecular weight of 523.47 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(2,3-dimethylphenyl)-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 136923543 |
| Molecular Formula | C22H34IN7 |
| Molecular Weight | 523.47 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C=CCN/C(=N\CCn1cnnc1CC)N1CCN(c2cccc(C)c2C)CC1.I |
| InChI | InChI=1S/C22H33N7.HI/c1-5-10-23-22(24-11-12-29-17-25-26-21(29)6-2)28-15-13-27(14-16-28)20-9-7-8-18(3)19(20)4;/h5,7-9,17H,1,6,10-16H2,2-4H3,(H,23,24);1H |
| InChIKey | QRLQQRGXEMEDFJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.47 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|