C24H31N7O — CID 111511791
N'-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide (PubChem CID 111511791) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is N'-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide.
| Compound Name | N'-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111511791 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | N'-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-hydroxyphenyl)piperazine-1-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\Cc1ccccc1)N1CCN(c2ccccc2O)CC1 |
| InChI | InChI=1S/C24H31N7O/c1-2-23-28-27-19-31(23)13-12-25-24(26-18-20-8-4-3-5-9-20)30-16-14-29(15-17-30)21-10-6-7-11-22(21)32/h3-11,19,32H,2,12-18H2,1H3,(H,25,26) |
| InChIKey | DZOLXYAQFNAESW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|