C21H33N7O — CID 111493354
4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide (PubChem CID 111493354) has the molecular formula C21H33N7O and a molecular weight of 399.54 g/mol. Its IUPAC name is 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111493354 |
| Molecular Formula | C21H33N7O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | 4-benzyl-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methoxyethyl)piperazine-1-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\CCOC)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H33N7O/c1-3-20-25-24-18-28(20)11-9-22-21(23-10-16-29-2)27-14-12-26(13-15-27)17-19-7-5-4-6-8-19/h4-8,18H,3,9-17H2,1-2H3,(H,22,23) |
| InChIKey | YBWRLVAFGQAZOV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|