C23H38IN7O2 — CID 111513517
1-(1-benzylpiperidin-4-yl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]guanidine;hydroiodide (PubChem CID 111513517) has the molecular formula C23H38IN7O2 and a molecular weight of 571.51 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111513517 |
| Molecular Formula | C23H38IN7O2 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(2-hydroxyethoxy)ethyl]guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CCOCCO)NC1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C23H37N7O2.HI/c1-2-22-28-26-19-30(22)14-10-24-23(25-11-16-32-17-15-31)27-21-8-12-29(13-9-21)18-20-6-4-3-5-7-20;/h3-7,19,21,31H,2,8-18H2,1H3,(H2,24,25,27);1H |
| InChIKey | YOAJMHQHAAUCDE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|