C26H39N7 — CID 111495434
1-(1-benzylpiperidin-4-yl)-3-(2-bicyclo[2.2.1]heptanyl)-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111495434) has the molecular formula C26H39N7 and a molecular weight of 449.65 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-(2-bicyclo[2.2.1]heptanyl)-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-(2-bicyclo[2.2.1]heptanyl)-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111495434 |
| Molecular Formula | C26H39N7 |
| Molecular Weight | 449.65 g/mol |
| Exact Mass | 449.33 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-(2-bicyclo[2.2.1]heptanyl)-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCc1nncn1CC/N=C(/NC1CCN(Cc2ccccc2)CC1)NC1CC2CCC1C2 |
| InChI | InChI=1S/C26H39N7/c1-2-25-31-28-19-33(25)15-12-27-26(30-24-17-21-8-9-22(24)16-21)29-23-10-13-32(14-11-23)18-20-6-4-3-5-7-20/h3-7,19,21-24H,2,8-18H2,1H3,(H2,27,29,30) |
| InChIKey | QGXFGSFBWDSZPX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.65 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|