C21H38IN7O2 — CID 111493139
ethyl 4-[[N-cyclohexyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111493139) has the molecular formula C21H38IN7O2 and a molecular weight of 547.49 g/mol. Its IUPAC name is ethyl 4-[[N-cyclohexyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N-cyclohexyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111493139 |
| Molecular Formula | C21H38IN7O2 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | ethyl 4-[[N-cyclohexyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]carbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCC(N/C(=N/CCn2cnnc2CC)NC2CCCCC2)CC1.I |
| InChI | InChI=1S/C21H37N7O2.HI/c1-3-19-26-23-16-28(19)15-12-22-20(24-17-8-6-5-7-9-17)25-18-10-13-27(14-11-18)21(29)30-4-2;/h16-18H,3-15H2,1-2H3,(H2,22,24,25);1H |
| InChIKey | WORNPMOSTFIFLG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|