C16H29N7O2 — CID 111328340
ethyl 4-[[N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 111328340) has the molecular formula C16H29N7O2 and a molecular weight of 351.46 g/mol. Its IUPAC name is ethyl 4-[[N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 111328340 |
| Molecular Formula | C16H29N7O2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | ethyl 4-[[N-ethyl-N'-[(4-ethyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1nncn1CC)NC1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C16H29N7O2/c1-4-17-15(18-11-14-21-19-12-22(14)5-2)20-13-7-9-23(10-8-13)16(24)25-6-3/h12-13H,4-11H2,1-3H3,(H2,17,18,20) |
| InChIKey | BOAXREBOXVBQPA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|