C16H30IN7O2 — CID 111329703
ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111329703) has the molecular formula C16H30IN7O2 and a molecular weight of 479.37 g/mol. Its IUPAC name is ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111329703 |
| Molecular Formula | C16H30IN7O2 |
| Molecular Weight | 479.37 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | ethyl 4-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C16H29N7O2.HI/c1-5-17-15(18-11-14-21-20-12(3)22(14)4)19-13-7-9-23(10-8-13)16(24)25-6-2;/h13H,5-11H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | LTLDTFHRHOUCRG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|