C15H27N7O2 — CID 111163392
ethyl 4-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163392) has the molecular formula C15H27N7O2 and a molecular weight of 337.43 g/mol. Its IUPAC name is ethyl 4-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163392 |
| Molecular Formula | C15H27N7O2 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | ethyl 4-[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C15H27N7O2/c1-5-16-14(17-11-13-19-18-12(3)20(13)4)21-7-9-22(10-8-21)15(23)24-6-2/h5-11H2,1-4H3,(H,16,17) |
| InChIKey | FXWSPZWDNDIVKZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|