C14H26IN7O2 — CID 111164036
ethyl 4-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111164036) has the molecular formula C14H26IN7O2 and a molecular weight of 451.31 g/mol. Its IUPAC name is ethyl 4-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111164036 |
| Molecular Formula | C14H26IN7O2 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | ethyl 4-[N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N/C)NCc2nnc(C)n2C)CC1.I |
| InChI | InChI=1S/C14H25N7O2.HI/c1-5-23-14(22)21-8-6-20(7-9-21)13(15-3)16-10-12-18-17-11(2)19(12)4;/h5-10H2,1-4H3,(H,15,16);1H |
| InChIKey | ATQLODYTVKIAHR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|