C19H30IN7 — CID 111347515
N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111347515) has the molecular formula C19H30IN7 and a molecular weight of 483.40 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111347515 |
| Molecular Formula | C19H30IN7 |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methyl-4-[(3-methylphenyl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N1CCN(Cc2cccc(C)c2)CC1.I |
| InChI | InChI=1S/C19H29N7.HI/c1-15-6-5-7-17(12-15)14-25-8-10-26(11-9-25)19(20-3)21-13-18-23-22-16(2)24(18)4;/h5-7,12H,8-11,13-14H2,1-4H3,(H,20,21);1H |
| InChIKey | APDAZITVWWKOGN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|