C16H24ClN7S — CID 111358850
4-[(5-chlorothiophen-2-yl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111358850) has the molecular formula C16H24ClN7S and a molecular weight of 381.94 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111358850 |
| Molecular Formula | C16H24ClN7S |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C16H24ClN7S/c1-12-20-21-15(22(12)3)10-19-16(18-2)24-8-6-23(7-9-24)11-13-4-5-14(17)25-13/h4-5H,6-11H2,1-3H3,(H,18,19) |
| InChIKey | RVDCLCFVLDKWQM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|