C17H26BrN7S — CID 111361045
4-[(5-bromothiophen-2-yl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 111361045) has the molecular formula C17H26BrN7S and a molecular weight of 440.42 g/mol. Its IUPAC name is 4-[(5-bromothiophen-2-yl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-[(5-bromothiophen-2-yl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111361045 |
| Molecular Formula | C17H26BrN7S |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 4-[(5-bromothiophen-2-yl)methyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)N1CCN(Cc2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C17H26BrN7S/c1-4-19-17(20-11-16-22-21-13(2)23(16)3)25-9-7-24(8-10-25)12-14-5-6-15(18)26-14/h5-6H,4,7-12H2,1-3H3,(H,19,20) |
| InChIKey | PDCNUTKZVWUCOX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|