C20H36N8O — CID 111419689
4-[2-(azepan-1-yl)-2-oxoethyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide (PubChem CID 111419689) has the molecular formula C20H36N8O and a molecular weight of 404.56 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide.
| Compound Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111419689 |
| Molecular Formula | C20H36N8O |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.30 |
| IUPAC Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-ethylpiperazine-1-carboximidamide |
| SMILES | CCN/C(=N\Cc1nnc(C)n1C)N1CCN(CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C20H36N8O/c1-4-21-20(22-15-18-24-23-17(2)25(18)3)28-13-11-26(12-14-28)16-19(29)27-9-7-5-6-8-10-27/h4-16H2,1-3H3,(H,21,22) |
| InChIKey | ZPWVHRDHSNMRFD-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|