C21H33IN8OS — CID 111367048
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111367048) has the molecular formula C21H33IN8OS and a molecular weight of 572.52 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111367048 |
| Molecular Formula | C21H33IN8OS |
| Molecular Weight | 572.52 g/mol |
| Exact Mass | 572.15 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-oxo-2-pyrrolidin-1-ylethyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | Cc1nnc(C/N=C(\NCc2cccs2)N2CCN(CC(=O)N3CCCC3)CC2)n1C.I |
| InChI | InChI=1S/C21H32N8OS.HI/c1-17-24-25-19(26(17)2)15-23-21(22-14-18-6-5-13-31-18)29-11-9-27(10-12-29)16-20(30)28-7-3-4-8-28;/h5-6,13H,3-4,7-12,14-16H2,1-2H3,(H,22,23);1H |
| InChIKey | KROXJQJLMGIQGW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.52 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|