C19H31N7S — CID 111327094
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111327094) has the molecular formula C19H31N7S and a molecular weight of 389.57 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111327094 |
| Molecular Formula | C19H31N7S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-4-(2-methylpropyl)-N-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
| SMILES | Cc1nnc(C/N=C(\NCc2cccs2)N2CCN(CC(C)C)CC2)n1C |
| InChI | InChI=1S/C19H31N7S/c1-15(2)14-25-7-9-26(10-8-25)19(20-12-17-6-5-11-27-17)21-13-18-23-22-16(3)24(18)4/h5-6,11,15H,7-10,12-14H2,1-4H3,(H,20,21) |
| InChIKey | HPBDHGXPRAKSSF-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|