C16H26N6S — CID 111001401
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbutan-2-yl)-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111001401) has the molecular formula C16H26N6S and a molecular weight of 334.49 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbutan-2-yl)-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbutan-2-yl)-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111001401 |
| Molecular Formula | C16H26N6S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(3-methylbutan-2-yl)-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCc2cccs2)NC(C)C(C)C)n1C |
| InChI | InChI=1S/C16H26N6S/c1-11(2)12(3)19-16(17-9-14-7-6-8-23-14)18-10-15-21-20-13(4)22(15)5/h6-8,11-12H,9-10H2,1-5H3,(H2,17,18,19) |
| InChIKey | WPIOUCRCBGTCII-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|