C18H21ClN6S — CID 111131574
2-[(4-chlorophenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111131574) has the molecular formula C18H21ClN6S and a molecular weight of 388.93 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111131574 |
| Molecular Formula | C18H21ClN6S |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | Cc1nnc(CN/C(=N/Cc2ccc(Cl)cc2)NCc2cccs2)n1C |
| InChI | InChI=1S/C18H21ClN6S/c1-13-23-24-17(25(13)2)12-22-18(21-11-16-4-3-9-26-16)20-10-14-5-7-15(19)8-6-14/h3-9H,10-12H2,1-2H3,(H2,20,21,22) |
| InChIKey | NDMNAFZDBMAMHB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|