C19H24N6S — CID 111899019
2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(5-methylthiophen-2-yl)methyl]guanidine (PubChem CID 111899019) has the molecular formula C19H24N6S and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(5-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(5-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111899019 |
| Molecular Formula | C19H24N6S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-benzyl-1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[(5-methylthiophen-2-yl)methyl]guanidine |
| SMILES | Cc1ccc(CN/C(=N\Cc2ccccc2)NCc2nnc(C)n2C)s1 |
| InChI | InChI=1S/C19H24N6S/c1-14-9-10-17(26-14)12-21-19(20-11-16-7-5-4-6-8-16)22-13-18-24-23-15(2)25(18)3/h4-10H,11-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | MUEQIOLLVCCNKZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|