C19H26N6S2 — CID 111581826
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-thiophen-2-ylpropyl)-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111581826) has the molecular formula C19H26N6S2 and a molecular weight of 402.59 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-thiophen-2-ylpropyl)-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-thiophen-2-ylpropyl)-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111581826 |
| Molecular Formula | C19H26N6S2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-(2-methyl-2-thiophen-2-ylpropyl)-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCc2cccs2)NCC(C)(C)c2cccs2)n1C |
| InChI | InChI=1S/C19H26N6S2/c1-14-23-24-17(25(14)4)12-21-18(20-11-15-7-5-9-26-15)22-13-19(2,3)16-8-6-10-27-16/h5-10H,11-13H2,1-4H3,(H2,20,21,22) |
| InChIKey | DKDLULTZKUBMAQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|