C19H30N6S — CID 111946723
1-(3-cyclopentylpropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111946723) has the molecular formula C19H30N6S and a molecular weight of 374.56 g/mol. Its IUPAC name is 1-(3-cyclopentylpropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 1-(3-cyclopentylpropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111946723 |
| Molecular Formula | C19H30N6S |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 1-(3-cyclopentylpropyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCCCC2CCCC2)NCc2cccs2)n1C |
| InChI | InChI=1S/C19H30N6S/c1-15-23-24-18(25(15)2)14-22-19(21-13-17-10-6-12-26-17)20-11-5-9-16-7-3-4-8-16/h6,10,12,16H,3-5,7-9,11,13-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | QXZATWRTXNROOI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|