C19H30N6O2S — CID 111407533
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(oxolan-2-ylmethoxy)propyl]-3-(thiophen-2-ylmethyl)guanidine (PubChem CID 111407533) has the molecular formula C19H30N6O2S and a molecular weight of 406.56 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(oxolan-2-ylmethoxy)propyl]-3-(thiophen-2-ylmethyl)guanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(oxolan-2-ylmethoxy)propyl]-3-(thiophen-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111407533 |
| Molecular Formula | C19H30N6O2S |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-[3-(oxolan-2-ylmethoxy)propyl]-3-(thiophen-2-ylmethyl)guanidine |
| SMILES | Cc1nnc(C/N=C(\NCCCOCC2CCCO2)NCc2cccs2)n1C |
| InChI | InChI=1S/C19H30N6O2S/c1-15-23-24-18(25(15)2)13-22-19(21-12-17-7-4-11-28-17)20-8-5-9-26-14-16-6-3-10-27-16/h4,7,11,16H,3,5-6,8-10,12-14H2,1-2H3,(H2,20,21,22) |
| InChIKey | PAGIXKWMSOIMON-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|