C14H24IN3O2S — CID 111783436
2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111783436) has the molecular formula C14H24IN3O2S and a molecular weight of 425.34 g/mol. Its IUPAC name is 2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111783436 |
| Molecular Formula | C14H24IN3O2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-methyl-1-[2-(oxolan-2-ylmethoxy)ethyl]-3-(thiophen-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOCC1CCCO1)NCc1cccs1.I |
| InChI | InChI=1S/C14H23N3O2S.HI/c1-15-14(17-10-13-5-3-9-20-13)16-6-8-18-11-12-4-2-7-19-12;/h3,5,9,12H,2,4,6-8,10-11H2,1H3,(H2,15,16,17);1H |
| InChIKey | QNRIXOGCSWYGHL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|