C18H27IN4O3S — CID 111407240
2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111407240) has the molecular formula C18H27IN4O3S and a molecular weight of 506.41 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111407240 |
| Molecular Formula | C18H27IN4O3S |
| Molecular Weight | 506.41 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-2-ylmethoxy)propyl]-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCOCC1CCCO1)NCc1coc(-c2cccs2)n1.I |
| InChI | InChI=1S/C18H26N4O3S.HI/c1-19-18(20-7-4-8-23-13-15-5-2-9-24-15)21-11-14-12-25-17(22-14)16-6-3-10-26-16;/h3,6,10,12,15H,2,4-5,7-9,11,13H2,1H3,(H2,19,20,21);1H |
| InChIKey | RABNJAWQXQVWFK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|