C17H28IN5O2S — CID 111651823
1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111651823) has the molecular formula C17H28IN5O2S and a molecular weight of 493.42 g/mol. Its IUPAC name is 1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111651823 |
| Molecular Formula | C17H28IN5O2S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 1-[2-[3-methoxypropyl(methyl)amino]ethyl]-2-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCN(C)CCCOC)NCc1coc(-c2cccs2)n1.I |
| InChI | InChI=1S/C17H27N5O2S.HI/c1-18-17(19-7-9-22(2)8-5-10-23-3)20-12-14-13-24-16(21-14)15-6-4-11-25-15;/h4,6,11,13H,5,7-10,12H2,1-3H3,(H2,18,19,20);1H |
| InChIKey | RYKZGKNDZQSEMU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|