C18H23IN4OS2 — CID 111673513
2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111673513) has the molecular formula C18H23IN4OS2 and a molecular weight of 502.45 g/mol. Its IUPAC name is 2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111673513 |
| Molecular Formula | C18H23IN4OS2 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-methyl-1-(2-methyl-3-thiophen-2-ylpropyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1coc(-c2cccs2)n1)NCC(C)Cc1cccs1.I |
| InChI | InChI=1S/C18H22N4OS2.HI/c1-13(9-15-5-3-7-24-15)10-20-18(19-2)21-11-14-12-23-17(22-14)16-6-4-8-25-16;/h3-8,12-13H,9-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | SQOXYZWSVRIQMX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|