C11H14N2O2S — CID 60671128
2-methoxy-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine (PubChem CID 60671128) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 2-methoxy-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 60671128 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 2-methoxy-N-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]ethanamine |
| SMILES | COCCNCc1coc(-c2cccs2)n1 |
| InChI | InChI=1S/C11H14N2O2S/c1-14-5-4-12-7-9-8-15-11(13-9)10-3-2-6-16-10/h2-3,6,8,12H,4-5,7H2,1H3 |
| InChIKey | WEOXMIQCZRHMLB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|