C15H20N2O3 — CID 65288161
N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine (PubChem CID 65288161) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 65288161 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-methoxyethanamine |
| SMILES | CCOc1ccccc1-c1nc(CNCCOC)co1 |
| InChI | InChI=1S/C15H20N2O3/c1-3-19-14-7-5-4-6-13(14)15-17-12(11-20-15)10-16-8-9-18-2/h4-7,11,16H,3,8-10H2,1-2H3 |
| InChIKey | MYJFSXHLAOJVNE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|