C20H22N2O3 — CID 56672823
N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline (PubChem CID 56672823) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline.
| Compound Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 56672823 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[[2-(2-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline |
| SMILES | CCOc1ccccc1-c1nc(CN(C)c2ccc(OC)cc2)co1 |
| InChI | InChI=1S/C20H22N2O3/c1-4-24-19-8-6-5-7-18(19)20-21-15(14-25-20)13-22(2)16-9-11-17(23-3)12-10-16/h5-12,14H,4,13H2,1-3H3 |
| InChIKey | HVUNWUXGADWEHY-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|