C18H17FN2O2 — CID 56662391
N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline (PubChem CID 56662391) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline.
| Compound Name | N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline |
|---|---|
| PubChem CID | 56662391 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]-4-methoxy-N-methylaniline |
| SMILES | COc1ccc(N(C)Cc2coc(-c3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C18H17FN2O2/c1-21(16-7-9-17(22-2)10-8-16)11-15-12-23-18(20-15)13-3-5-14(19)6-4-13/h3-10,12H,11H2,1-2H3 |
| InChIKey | CRTLZUMPVDIIPC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|