About N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline
N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline (PubChem CID 56665812) has the molecular formula C20H22N2O2
and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline.
Molecular Properties
| Compound Name | N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline |
| PubChem CID | 56665812 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline |
| SMILES | CCOc1ccc(-c2nc(CN(C)c3ccc(C)cc3)co2)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-4-23-19-11-7-16(8-12-19)20-21-17(14-24-20)13-22(3)18-9-5-15(2)6-10-18/h5-12,14H,4,13H2,1-3H3 |
| InChIKey | FSWIBPPPIVKEHX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline?
The IUPAC name of N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline (CID 56665812) is N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline.
What is the SMILES notation for N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline?
The canonical SMILES for N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline is CCOc1ccc(-c2nc(CN(C)c3ccc(C)cc3)co2)cc1.
What is the InChIKey of N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline?
The InChIKey is FSWIBPPPIVKEHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N2O2/c1-4-23-19-11-7-16(8-12-19)20-21-17(14-24-20)13-22(3)18-9-5-15(2)6-10-18/h5-12,14H,4,13H2,1-3H3.
What are the key properties of N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline?
N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline has a molecular weight of 322.41 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline is sourced from PubChem (CID 56665812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).