C20H22N2O2 — CID 56665812
N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline (PubChem CID 56665812) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline.
| Compound Name | N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline |
|---|---|
| PubChem CID | 56665812 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-N,4-dimethylaniline |
| SMILES | CCOc1ccc(-c2nc(CN(C)c3ccc(C)cc3)co2)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-4-23-19-11-7-16(8-12-19)20-21-17(14-24-20)13-22(3)18-9-5-15(2)6-10-18/h5-12,14H,4,13H2,1-3H3 |
| InChIKey | FSWIBPPPIVKEHX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|