C15H16N2O — CID 56671957
N-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]prop-2-yn-1-amine (PubChem CID 56671957) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is N-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]prop-2-yn-1-amine.
| Compound Name | N-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 56671957 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | N-methyl-N-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]prop-2-yn-1-amine |
| SMILES | C#CCN(C)Cc1coc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C15H16N2O/c1-4-9-17(3)10-14-11-18-15(16-14)13-7-5-12(2)6-8-13/h1,5-8,11H,9-10H2,2-3H3 |
| InChIKey | GUGZMDDVBJCQBE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|