C20H22N2O3 — CID 56679919
N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-phenoxyethanamine (PubChem CID 56679919) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-phenoxyethanamine.
| Compound Name | N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-phenoxyethanamine |
|---|---|
| PubChem CID | 56679919 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]-2-phenoxyethanamine |
| SMILES | CCOc1ccc(-c2nc(CNCCOc3ccccc3)co2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-2-23-19-10-8-16(9-11-19)20-22-17(15-25-20)14-21-12-13-24-18-6-4-3-5-7-18/h3-11,15,21H,2,12-14H2,1H3 |
| InChIKey | ROYFXAHYAUXTGB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|