C22H26N2O4 — CID 56659063
2-(2,5-dimethoxyphenyl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine (PubChem CID 56659063) has the molecular formula C22H26N2O4 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine.
| Compound Name | 2-(2,5-dimethoxyphenyl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 56659063 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-N-[[2-(4-ethoxyphenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
| SMILES | CCOc1ccc(-c2nc(CNCCc3cc(OC)ccc3OC)co2)cc1 |
| InChI | InChI=1S/C22H26N2O4/c1-4-27-19-7-5-16(6-8-19)22-24-18(15-28-22)14-23-12-11-17-13-20(25-2)9-10-21(17)26-3/h5-10,13,15,23H,4,11-12,14H2,1-3H3 |
| InChIKey | VRTIPYWCUUQRKG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|