C20H21FN2O3 — CID 56673253
2-(3,4-dimethoxyphenyl)-N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]ethanamine (PubChem CID 56673253) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]ethanamine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 56673253 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[[2-(4-fluorophenyl)-1,3-oxazol-4-yl]methyl]ethanamine |
| SMILES | COc1ccc(CCNCc2coc(-c3ccc(F)cc3)n2)cc1OC |
| InChI | InChI=1S/C20H21FN2O3/c1-24-18-8-3-14(11-19(18)25-2)9-10-22-12-17-13-26-20(23-17)15-4-6-16(21)7-5-15/h3-8,11,13,22H,9-10,12H2,1-2H3 |
| InChIKey | NORQKWKEMUJIGJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|