C21H23FN2O4 — CID 119123449
2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine (PubChem CID 119123449) has the molecular formula C21H23FN2O4 and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine.
| Compound Name | 2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 119123449 |
| Molecular Formula | C21H23FN2O4 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine |
| SMILES | COc1ccc(CNCCc2coc(-c3ccc(F)cc3)n2)c(OC)c1OC |
| InChI | InChI=1S/C21H23FN2O4/c1-25-18-9-6-15(19(26-2)20(18)27-3)12-23-11-10-17-13-28-21(24-17)14-4-7-16(22)8-5-14/h4-9,13,23H,10-12H2,1-3H3 |
| InChIKey | UQURMELIKPWGMY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 65.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|