C18H15F2N3O4 — CID 133360951
4-fluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-5-methoxy-2-nitroaniline (PubChem CID 133360951) has the molecular formula C18H15F2N3O4 and a molecular weight of 375.33 g/mol. Its IUPAC name is 4-fluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-5-methoxy-2-nitroaniline.
| Compound Name | 4-fluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-5-methoxy-2-nitroaniline |
|---|---|
| PubChem CID | 133360951 |
| Molecular Formula | C18H15F2N3O4 |
| Molecular Weight | 375.33 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 4-fluoro-N-[2-[2-(4-fluorophenyl)-1,3-oxazol-4-yl]ethyl]-5-methoxy-2-nitroaniline |
| SMILES | COc1cc(NCCc2coc(-c3ccc(F)cc3)n2)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C18H15F2N3O4/c1-26-17-9-15(16(23(24)25)8-14(17)20)21-7-6-13-10-27-18(22-13)11-2-4-12(19)5-3-11/h2-5,8-10,21H,6-7H2,1H3 |
| InChIKey | ROOIOYRKECRSGE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.33 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|