C20H24FNO7 — CID 17367731
2-(4-fluorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine;oxalic acid (PubChem CID 17367731) has the molecular formula C20H24FNO7 and a molecular weight of 409.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(4-fluorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 17367731 |
| Molecular Formula | C20H24FNO7 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[(2,3,4-trimethoxyphenyl)methyl]ethanamine;oxalic acid |
| SMILES | COc1ccc(CNCCc2ccc(F)cc2)c(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22FNO3.C2H2O4/c1-21-16-9-6-14(17(22-2)18(16)23-3)12-20-11-10-13-4-7-15(19)8-5-13;3-1(4)2(5)6/h4-9,20H,10-12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | NBFMFSIEWXUFTP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|