C20H24FNO6 — CID 17367514
N-[(2,4-dimethoxy-3-methylphenyl)methyl]-2-(3-fluorophenyl)ethanamine;oxalic acid (PubChem CID 17367514) has the molecular formula C20H24FNO6 and a molecular weight of 393.41 g/mol. Its IUPAC name is N-[(2,4-dimethoxy-3-methylphenyl)methyl]-2-(3-fluorophenyl)ethanamine;oxalic acid.
| Compound Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-2-(3-fluorophenyl)ethanamine;oxalic acid |
|---|---|
| PubChem CID | 17367514 |
| Molecular Formula | C20H24FNO6 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | N-[(2,4-dimethoxy-3-methylphenyl)methyl]-2-(3-fluorophenyl)ethanamine;oxalic acid |
| SMILES | COc1ccc(CNCCc2cccc(F)c2)c(OC)c1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H22FNO2.C2H2O4/c1-13-17(21-2)8-7-15(18(13)22-3)12-20-10-9-14-5-4-6-16(19)11-14;3-1(4)2(5)6/h4-8,11,20H,9-10,12H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | BCNSXWKLGKTFCP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|