C23H23NO7 — CID 126468857
2-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]ethanamine;oxalic acid (PubChem CID 126468857) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]ethanamine;oxalic acid.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]ethanamine;oxalic acid |
|---|---|
| PubChem CID | 126468857 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N-[(4-methoxynaphthalen-1-yl)methyl]ethanamine;oxalic acid |
| SMILES | COc1ccc(CNCCc2ccc3c(c2)OCO3)c2ccccc12.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H21NO3.C2H2O4/c1-23-19-9-7-16(17-4-2-3-5-18(17)19)13-22-11-10-15-6-8-20-21(12-15)25-14-24-20;3-1(4)2(5)6/h2-9,12,22H,10-11,13-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | CVKOFBLFLJMORL-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|