C13H20N2O4 — CID 43553337
3-[(2,3,4-trimethoxyphenyl)methylamino]propanamide (PubChem CID 43553337) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-[(2,3,4-trimethoxyphenyl)methylamino]propanamide.
| Compound Name | 3-[(2,3,4-trimethoxyphenyl)methylamino]propanamide |
|---|---|
| PubChem CID | 43553337 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3-[(2,3,4-trimethoxyphenyl)methylamino]propanamide |
| SMILES | COc1ccc(CNCCC(N)=O)c(OC)c1OC |
| InChI | InChI=1S/C13H20N2O4/c1-17-10-5-4-9(8-15-7-6-11(14)16)12(18-2)13(10)19-3/h4-5,15H,6-8H2,1-3H3,(H2,14,16) |
| InChIKey | WOFBGGUQDMIDKL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|