C14H23NO4S — CID 115632884
3-methylsulfinyl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine (PubChem CID 115632884) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is 3-methylsulfinyl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine.
| Compound Name | 3-methylsulfinyl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115632884 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-methylsulfinyl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine |
| SMILES | COc1ccc(CNCCCS(C)=O)c(OC)c1OC |
| InChI | InChI=1S/C14H23NO4S/c1-17-12-7-6-11(13(18-2)14(12)19-3)10-15-8-5-9-20(4)16/h6-7,15H,5,8-10H2,1-4H3 |
| InChIKey | BVNHDWIRNNLKDO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|