C14H24N2O3 — CID 60895231
N'-[(2,3,4-trimethoxyphenyl)methyl]butane-1,4-diamine (PubChem CID 60895231) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is N'-[(2,3,4-trimethoxyphenyl)methyl]butane-1,4-diamine.
| Compound Name | N'-[(2,3,4-trimethoxyphenyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 60895231 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N'-[(2,3,4-trimethoxyphenyl)methyl]butane-1,4-diamine |
| SMILES | COc1ccc(CNCCCCN)c(OC)c1OC |
| InChI | InChI=1S/C14H24N2O3/c1-17-12-7-6-11(10-16-9-5-4-8-15)13(18-2)14(12)19-3/h6-7,16H,4-5,8-10,15H2,1-3H3 |
| InChIKey | IAIHOFTVVGSMPQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|