C11H18N2O2 — CID 60888346
N'-[(2,3-dimethoxyphenyl)methyl]ethane-1,2-diamine (PubChem CID 60888346) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is N'-[(2,3-dimethoxyphenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(2,3-dimethoxyphenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 60888346 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | N'-[(2,3-dimethoxyphenyl)methyl]ethane-1,2-diamine |
| SMILES | COc1cccc(CNCCN)c1OC |
| InChI | InChI=1S/C11H18N2O2/c1-14-10-5-3-4-9(11(10)15-2)8-13-7-6-12/h3-5,13H,6-8,12H2,1-2H3 |
| InChIKey | MYYDJXSDECXQEK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|