C12H20ClNO3 — CID 17295657
N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride (PubChem CID 17295657) has the molecular formula C12H20ClNO3 and a molecular weight of 261.75 g/mol. Its IUPAC name is N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride.
| Compound Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride |
|---|---|
| PubChem CID | 17295657 |
| Molecular Formula | C12H20ClNO3 |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-[(2,3-dimethoxyphenyl)methyl]-2-methoxyethanamine;hydrochloride |
| SMILES | COCCNCc1cccc(OC)c1OC.Cl |
| InChI | InChI=1S/C12H19NO3.ClH/c1-14-8-7-13-9-10-5-4-6-11(15-2)12(10)16-3;/h4-6,13H,7-9H2,1-3H3;1H |
| InChIKey | VTCZSHHNMOLZHN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|