C11H17NO3 — CID 4717256
2-[(2,3-dimethoxyphenyl)methylamino]ethanol (PubChem CID 4717256) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methylamino]ethanol.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methylamino]ethanol |
|---|---|
| PubChem CID | 4717256 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methylamino]ethanol |
| SMILES | COc1cccc(CNCCO)c1OC |
| InChI | InChI=1S/C11H17NO3/c1-14-10-5-3-4-9(11(10)15-2)8-12-6-7-13/h3-5,12-13H,6-8H2,1-2H3 |
| InChIKey | IBZJURZOPHGTJF-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|