C17H21ClFNO3 — CID 2951461
2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol;hydrochloride (PubChem CID 2951461) has the molecular formula C17H21ClFNO3 and a molecular weight of 341.81 g/mol. Its IUPAC name is 2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol;hydrochloride.
| Compound Name | 2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 2951461 |
| Molecular Formula | C17H21ClFNO3 |
| Molecular Weight | 341.81 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 2-[[2-[(2-fluorophenyl)methoxy]-3-methoxyphenyl]methylamino]ethanol;hydrochloride |
| SMILES | COc1cccc(CNCCO)c1OCc1ccccc1F.Cl |
| InChI | InChI=1S/C17H20FNO3.ClH/c1-21-16-8-4-6-13(11-19-9-10-20)17(16)22-12-14-5-2-3-7-15(14)18;/h2-8,19-20H,9-12H2,1H3;1H |
| InChIKey | PXOFNRXUCXRPJZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.81 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|